Products 1983185-30-3

CAS 1983185-30-3 is the registry number for 2-Acetamido-2-(hept-6-en-1-yl)malonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-acetamido-2-hept-6-enylpropanedioic acid (CAS 1983185-30-3) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 2-acetamido-2-hept-6-enylpropanedioic acid. InChIKey: AGGJGFVTXARKDV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO5
Molecular weight257.28 g/mol
IUPAC name2-acetamido-2-hept-6-enylpropanedioic acid
InChIKeyAGGJGFVTXARKDV-UHFFFAOYSA-N
SMILESCC(=O)NC(CCCCCC=C)(C(=O)O)C(=O)O

Computed by PubChem (NCBI)