CAS 19872-93-6 appears in our catalog under these names: 2,6-Dimethyl 4-methoxypyridine-2,6-dicarboxylate, 98%, 2,6-Dimethyl 4-methoxypyridine-2,6-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl 4-methoxypyridine-2,6-dicarboxylate (CAS 19872-93-6) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: dimethyl 4-methoxypyridine-2,6-dicarboxylate. InChIKey: NFIRNYBABWFVNL-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | dimethyl 4-methoxypyridine-2,6-dicarboxylate |
| InChIKey | NFIRNYBABWFVNL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)