CAS 1987263-49-9 is the registry number for Ethyl 2-(4-methoxybenzyl)-5-phenyl-2h-1,2,6-thiadiazine-4-carboxylate 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Ethyl 2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate (CAS 1987263-49-9) is a chemical compound with the molecular formula C20H20N2O5S and a molecular weight of 400.4 g/mol. IUPAC name: ethyl 2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate. InChIKey: USTCFIDQORBGDA-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O5S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | ethyl 2-[(4-methoxyphenyl)methyl]-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate |
| InChIKey | USTCFIDQORBGDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(S(=O)(=O)N=C1C2=CC=CC=C2)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)