Products 2923009-48-5
CAS 2923009-48-5 appears in our catalog under these names: WRN inhibitor 3, WRN inhibitor 3, 99.54%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.
6-[2-(cyclopropylmethoxy)phenyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-oxo-1H-pyridine-3-carboxamide (CAS 2923009-48-5) is a chemical compound with the molecular formula C20H20N2O5S and a molecular weight of 400.4 g/mol. IUPAC name: 6-[2-(cyclopropylmethoxy)phenyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-oxo-1H-pyridine-3-carboxamide. InChIKey: OCAWWHPFNVVCII-CQSZACIVSA-N.
| Molecular formula | C20H20N2O5S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 6-[2-(cyclopropylmethoxy)phenyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | OCAWWHPFNVVCII-CQSZACIVSA-N |
| SMILES | C1CC1COC2=CC=CC=C2C3=CC=C(C(=O)N3)C(=O)N[C@H]4CS(=O)(=O)C=C4 |
Computed by PubChem (NCBI)
Synonyms:
WRN inhibitor 3, orb1943989