CAS 791795-65-8 is the registry number for 2-((4-(N,N-Diallylsulfamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 791795-65-8) is a chemical compound with the molecular formula C20H20N2O5S and a molecular weight of 400.4 g/mol. IUPAC name: 2-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: FJVXKRVCJIFWCF-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O5S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 2-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamoyl]benzoic acid |
| InChIKey | FJVXKRVCJIFWCF-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)S(=O)(=O)C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)