Products 1443324-12-6
CAS 1443324-12-6 appears in our catalog under these names: Fmoc-L-Cys(Cam)-OH, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-S-(2-amino-2-oxoethyl)-L-cysteine, ≥97%, ≥97%. Offered by: Iris Biotech, Biosynth, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
(2R)-3-(2-amino-2-oxoethyl)sulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1443324-12-6) is a chemical compound with the molecular formula C20H20N2O5S and a molecular weight of 400.4 g/mol. IUPAC name: (2R)-3-(2-amino-2-oxoethyl)sulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NAKVFAQHYDUSNZ-KRWDZBQOSA-N.
| Molecular formula | C20H20N2O5S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | (2R)-3-(2-amino-2-oxoethyl)sulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NAKVFAQHYDUSNZ-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CSCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)