Products 1987332-74-0

CAS 1987332-74-0 is the registry number for Ethyl cis-3-amino-1-methylcyclobutanecarboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-1-methylcyclobutane-1-carboxylate;hydrochloride (CAS 1987332-74-0) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: ethyl 3-amino-1-methylcyclobutane-1-carboxylate;hydrochloride. InChIKey: FMMZLCYSKLNGPT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC nameethyl 3-amino-1-methylcyclobutane-1-carboxylate;hydrochloride
InChIKeyFMMZLCYSKLNGPT-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC(C1)N)C.Cl

Computed by PubChem (NCBI)