Products 1989638-04-1
CAS 1989638-04-1 is the registry number for rac-((2R,3S)-2-(1-Ethyl-1H-pyrazol-4-yl)oxan-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]methanol (CAS 1989638-04-1) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: [(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]methanol. InChIKey: WVNNLBHPEQBZEI-GXSJLCMTSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | [(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]methanol |
| InChIKey | WVNNLBHPEQBZEI-GXSJLCMTSA-N |
| SMILES | CCN1C=C(C=N1)[C@H]2[C@@H](CCCO2)CO |
Computed by PubChem (NCBI)