Products 1989671-47-7
CAS 1989671-47-7 is the registry number for 1,2,3,4,7,8-Hexahydro-1,7-naphthyridin-8-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3,4,7-tetrahydro-1H-1,7-naphthyridin-8-one;hydrochloride (CAS 1989671-47-7) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: 2,3,4,7-tetrahydro-1H-1,7-naphthyridin-8-one;hydrochloride. InChIKey: IQWCJIFZECOLNY-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | 2,3,4,7-tetrahydro-1H-1,7-naphthyridin-8-one;hydrochloride |
| InChIKey | IQWCJIFZECOLNY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC=C2)NC1.Cl |
Computed by PubChem (NCBI)