CAS 1989672-67-4 is the registry number for Ethyl 2-amino-2-cyclopropyl-3,3,3-trifluoropropanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-amino-2-cyclopropyl-3,3,3-trifluoropropanoate;hydrochloride (CAS 1989672-67-4) is a chemical compound with the molecular formula C8H13ClF3NO2 and a molecular weight of 247.64 g/mol. IUPAC name: ethyl 2-amino-2-cyclopropyl-3,3,3-trifluoropropanoate;hydrochloride. InChIKey: RTAVJWGFALYABU-UHFFFAOYSA-N.
| Molecular formula | C8H13ClF3NO2 |
|---|---|
| Molecular weight | 247.64 g/mol |
| IUPAC name | ethyl 2-amino-2-cyclopropyl-3,3,3-trifluoropropanoate;hydrochloride |
| InChIKey | RTAVJWGFALYABU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1CC1)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)