Products 2955543-56-1
CAS 2955543-56-1 appears in our catalog under these names: 1-amino-4-(trifluoromethyl)cyclohexanecarboxylic acid,hydrochloride, 95%, 1-amino-4-(trifluoromethyl)cyclohexanecarboxylic acid,hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid;hydrochloride (CAS 2955543-56-1) is a chemical compound with the molecular formula C8H13ClF3NO2 and a molecular weight of 247.64 g/mol. IUPAC name: 1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid;hydrochloride. InChIKey: AAGYMWBEMRIVSS-UHFFFAOYSA-N.
| Molecular formula | C8H13ClF3NO2 |
|---|---|
| Molecular weight | 247.64 g/mol |
| IUPAC name | 1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | AAGYMWBEMRIVSS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(F)(F)F)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)