CAS 2007924-97-0 appears in our catalog under these names: cis-Methyl 5-(trifluoromethyl)piperidine-3-carboxylate hydrochloride, 97%, rac-methyl (3R,5S)-5-(trifluoromethyl)piperidine-3-carboxylate hydrochloride, cis. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl (3R,5S)-5-(trifluoromethyl)piperidine-3-carboxylate;hydrochloride (CAS 2007924-97-0) is a chemical compound with the molecular formula C8H13ClF3NO2 and a molecular weight of 247.64 g/mol. IUPAC name: methyl (3R,5S)-5-(trifluoromethyl)piperidine-3-carboxylate;hydrochloride. InChIKey: SOQCKSUYTCVIEI-IBTYICNHSA-N.
| Molecular formula | C8H13ClF3NO2 |
|---|---|
| Molecular weight | 247.64 g/mol |
| IUPAC name | methyl (3R,5S)-5-(trifluoromethyl)piperidine-3-carboxylate;hydrochloride |
| InChIKey | SOQCKSUYTCVIEI-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CNC1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)