CAS 19898-34-1 is the registry number for Ac-Tyr-Phe-OMe. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
Methyl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate (CAS 19898-34-1) is a chemical compound with the molecular formula C21H24N2O5 and a molecular weight of 384.4 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate. InChIKey: FMKAXMXOQRFJPK-OALUTQOASA-N.
| Molecular formula | C21H24N2O5 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate |
| InChIKey | FMKAXMXOQRFJPK-OALUTQOASA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)