Products 84163-47-3
CAS 84163-47-3 is the registry number for (E)-2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl-methanone Oxime. Offered by: TRC. Available pack sizes: 250mg.
Benzyl 4-[(E)-N-hydroxy-C-(2-hydroxy-4-methoxyphenyl)carbonimidoyl]piperidine-1-carboxylate (CAS 84163-47-3) is a chemical compound with the molecular formula C21H24N2O5 and a molecular weight of 384.4 g/mol. IUPAC name: benzyl 4-[(E)-N-hydroxy-C-(2-hydroxy-4-methoxyphenyl)carbonimidoyl]piperidine-1-carboxylate. InChIKey: OMXRTLYHQCREKX-LSDHQDQOSA-N.
| Molecular formula | C21H24N2O5 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | benzyl 4-[(E)-N-hydroxy-C-(2-hydroxy-4-methoxyphenyl)carbonimidoyl]piperidine-1-carboxylate |
| InChIKey | OMXRTLYHQCREKX-LSDHQDQOSA-N |
| SMILES | COC1=CC(=C(C=C1)/C(=N/O)/C2CCN(CC2)C(=O)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)