CAS 83861-02-3 appears in our catalog under these names: SCH 32615, 98+%, SCH 32615, Sch 32615, Sch 32615, 99.68%, 99.68%, SCH 32615, 99.68%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 2mg, 10mM/1mL, 5 mg.
(2S)-2-[[(2S)-1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-3-phenylpropanoic acid (CAS 83861-02-3) is a chemical compound with the molecular formula C21H24N2O5 and a molecular weight of 384.4 g/mol. IUPAC name: (2S)-2-[[(2S)-1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-3-phenylpropanoic acid. InChIKey: WOVRTBFSWOVRST-ROUUACIJSA-N.
| Molecular formula | C21H24N2O5 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-3-phenylpropanoic acid |
| InChIKey | WOVRTBFSWOVRST-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCCC(=O)O)N[C@@H](CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)