CAS 94497-33-3 appears in our catalog under these names: 3-(2,6-Dioxopiperidin-1-yl)propanoic acid, 95%, 3-(2,6-Dioxopiperidin-1-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(2,6-dioxopiperidin-1-yl)propanoic acid (CAS 94497-33-3) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-1-yl)propanoic acid. InChIKey: LRSYPIMZSNLPLN-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-1-yl)propanoic acid |
| InChIKey | LRSYPIMZSNLPLN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1)CCC(=O)O |
Computed by PubChem (NCBI)