CAS 19930-62-2 is the registry number for 1,4-Dibromo-2,3-dimethylnaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dibromo-2,3-dimethylnaphthalene (CAS 19930-62-2) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 1,4-dibromo-2,3-dimethylnaphthalene. InChIKey: BXGGIFNLEHESMX-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2 |
|---|---|
| Molecular weight | 314.01 g/mol |
| IUPAC name | 1,4-dibromo-2,3-dimethylnaphthalene |
| InChIKey | BXGGIFNLEHESMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1C)Br)Br |
Computed by PubChem (NCBI)