CAS 4542-77-2 appears in our catalog under these names: 2,6-Bis(bromomethyl)naphthalene, 2,6-Bis(bromomethyl)naphthalene 97%, 2,6-BIS(BROMOMETHYL)NAPHTHALENE, 95%. Offered by: TRC, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 10g.
2,6-bis(bromomethyl)naphthalene (CAS 4542-77-2) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 2,6-bis(bromomethyl)naphthalene. InChIKey: JRHSGFPVPTWMND-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2 |
|---|---|
| Molecular weight | 314.01 g/mol |
| IUPAC name | 2,6-bis(bromomethyl)naphthalene |
| InChIKey | JRHSGFPVPTWMND-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CBr)C=C1CBr |
Computed by PubChem (NCBI)