CAS 21646-18-4 is the registry number for 1,5-Bis(bromomethyl)naphthalene. Offered by: TRC. Available pack sizes: 5g.
1,5-bis(bromomethyl)naphthalene (CAS 21646-18-4) is a chemical compound with the molecular formula C12H10Br2 and a molecular weight of 314.01 g/mol. IUPAC name: 1,5-bis(bromomethyl)naphthalene. InChIKey: ZNHUYTIFYQXOCM-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2 |
|---|---|
| Molecular weight | 314.01 g/mol |
| IUPAC name | 1,5-bis(bromomethyl)naphthalene |
| InChIKey | ZNHUYTIFYQXOCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)CBr)CBr |
Computed by PubChem (NCBI)