CAS 1993160-77-2 is the registry number for 2-(2,5-Dichlorophenyl)benzo[d]oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-dichlorophenyl)-1,3-benzoxazole-5-carbaldehyde (CAS 1993160-77-2) is a chemical compound with the molecular formula C14H7Cl2NO2 and a molecular weight of 292.1 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-1,3-benzoxazole-5-carbaldehyde. InChIKey: SDOALNPNKCOPTL-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2NO2 |
|---|---|
| Molecular weight | 292.1 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-1,3-benzoxazole-5-carbaldehyde |
| InChIKey | SDOALNPNKCOPTL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)N=C(O2)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)