CAS 943430-62-4 is the registry number for 4,7-Dichloro-2-phenyl-1H-isoindole-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
4,7-dichloro-2-phenylisoindole-1,3-dione (CAS 943430-62-4) is a chemical compound with the molecular formula C14H7Cl2NO2 and a molecular weight of 292.1 g/mol. IUPAC name: 4,7-dichloro-2-phenylisoindole-1,3-dione. InChIKey: KOHXUUGDPVMHJZ-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2NO2 |
|---|---|
| Molecular weight | 292.1 g/mol |
| IUPAC name | 4,7-dichloro-2-phenylisoindole-1,3-dione |
| InChIKey | KOHXUUGDPVMHJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(C=CC(=C3C2=O)Cl)Cl |
Computed by PubChem (NCBI)