CAS 5355-88-4 is the registry number for 1-Amino-6,7-dichloroanthracene-9,10-dione, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-amino-6,7-dichloroanthracene-9,10-dione (CAS 5355-88-4) is a chemical compound with the molecular formula C14H7Cl2NO2 and a molecular weight of 292.1 g/mol. IUPAC name: 1-amino-6,7-dichloroanthracene-9,10-dione. InChIKey: YFEHGCGWUWOAFA-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2NO2 |
|---|---|
| Molecular weight | 292.1 g/mol |
| IUPAC name | 1-amino-6,7-dichloroanthracene-9,10-dione |
| InChIKey | YFEHGCGWUWOAFA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)C3=CC(=C(C=C3C2=O)Cl)Cl |
Computed by PubChem (NCBI)