CAS 1993188-89-8 appears in our catalog under these names: 3-Amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide hydrochloride, 95%, 3-Amino-7-oxabicyclo(2.2.1)hept-5-ene-2-carboxamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride (CAS 1993188-89-8) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride. InChIKey: QIIGTZNNUVRAJM-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide;hydrochloride |
| InChIKey | QIIGTZNNUVRAJM-UHFFFAOYSA-N |
| SMILES | C1=CC2C(C(C1O2)C(=O)N)N.Cl |
Computed by PubChem (NCBI)