Products 1993194-84-5

CAS 1993194-84-5 is the registry number for 2-(Azepan-1-ylmethyl)-4-methoxybenzaldehyde hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(azepan-1-ylmethyl)-4-methoxybenzaldehyde;hydrobromide (CAS 1993194-84-5) is a chemical compound with the molecular formula C15H22BrNO2 and a molecular weight of 328.24 g/mol. IUPAC name: 2-(azepan-1-ylmethyl)-4-methoxybenzaldehyde;hydrobromide. InChIKey: MEUZAADRMLRDDO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22BrNO2
Molecular weight328.24 g/mol
IUPAC name2-(azepan-1-ylmethyl)-4-methoxybenzaldehyde;hydrobromide
InChIKeyMEUZAADRMLRDDO-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C=O)CN2CCCCCC2.Br

Computed by PubChem (NCBI)