CAS 2227272-55-9 is the registry number for tert-Butyl 3-bromo-5-isopropylbenzylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl N-[(3-bromo-5-propan-2-ylphenyl)methyl]carbamate (CAS 2227272-55-9) is a chemical compound with the molecular formula C15H22BrNO2 and a molecular weight of 328.24 g/mol. IUPAC name: tert-butyl N-[(3-bromo-5-propan-2-ylphenyl)methyl]carbamate. InChIKey: YTRZSMAGYGKDTR-UHFFFAOYSA-N.
| Molecular formula | C15H22BrNO2 |
|---|---|
| Molecular weight | 328.24 g/mol |
| IUPAC name | tert-butyl N-[(3-bromo-5-propan-2-ylphenyl)methyl]carbamate |
| InChIKey | YTRZSMAGYGKDTR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)CNC(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)