Products 2279121-98-9

CAS 2279121-98-9 is the registry number for (5-Bromo-2-methyl-benzyl)-ethyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Tert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-ethylcarbamate (CAS 2279121-98-9) is a chemical compound with the molecular formula C15H22BrNO2 and a molecular weight of 328.24 g/mol. IUPAC name: tert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-ethylcarbamate. InChIKey: NIEZHUQQPMDQAP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22BrNO2
Molecular weight328.24 g/mol
IUPAC nametert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-ethylcarbamate
InChIKeyNIEZHUQQPMDQAP-UHFFFAOYSA-N
SMILESCCN(CC1=C(C=CC(=C1)Br)C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)