Products 1993243-79-0
CAS 1993243-79-0 appears in our catalog under these names: 5-(3-Fluoro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid, 95%, 5-(3-FLUORO-4-METHYLPHENYL)-1H-PYRROLE-2-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg.
5-(3-fluoro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid (CAS 1993243-79-0) is a chemical compound with the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. IUPAC name: 5-(3-fluoro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: DDZKXEFJFUDRDD-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 5-(3-fluoro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | DDZKXEFJFUDRDD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(N2)C(=O)O)F |
Computed by PubChem (NCBI)