CAS 199335-36-9 is the registry number for 6-Fluoro-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 199335-36-9) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: GHYIDVTWFWGMSW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | GHYIDVTWFWGMSW-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(O1)C=CC(=C2)F)N)C.Cl |
Computed by PubChem (NCBI)