CAS 390744-78-2 appears in our catalog under these names: (S)-6-Fluoro-2,2-dimethylchroman-4-amine hydrochloride, 95+%, (S)-6-Fluoro-2,2-dimethylchroman-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 390744-78-2) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: (4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: GHYIDVTWFWGMSW-FVGYRXGTSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | (4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | GHYIDVTWFWGMSW-FVGYRXGTSA-N |
| SMILES | CC1(C[C@@H](C2=C(O1)C=CC(=C2)F)N)C.Cl |
Computed by PubChem (NCBI)