CAS 1993384-28-3 is the registry number for Boc-L-Phe(4-iBu)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 1993384-28-3) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 321.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: JQKDKBQMAABWKP-HNNXBMFYSA-N.
| Molecular formula | C18H27NO4 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | JQKDKBQMAABWKP-HNNXBMFYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)