CAS 19938-06-8 is the registry number for 3-Mesitylpropanal, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,4,6-trimethylphenyl)propanal (CAS 19938-06-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 3-(2,4,6-trimethylphenyl)propanal. InChIKey: ZKIPEUIKAACMKE-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 3-(2,4,6-trimethylphenyl)propanal |
| InChIKey | ZKIPEUIKAACMKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CCC=O)C |
Computed by PubChem (NCBI)