CAS 19940-17-1 appears in our catalog under these names: (2S,3R,4S,5R,6R)–2–methoxy–6–methyltetrahydro–2H–pyran–3,4,5–triyl triacetate, Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 2g, 5g, 10g.
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate (CAS 19940-17-1) is a chemical compound with the molecular formula C13H20O8 and a molecular weight of 304.29 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate. InChIKey: RTVWBDNQHISFHI-QPSDPIORSA-N.
| Molecular formula | C13H20O8 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate |
| InChIKey | RTVWBDNQHISFHI-QPSDPIORSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)