CAS 24333-02-6 is the registry number for (2R,3S,4R,5R,6S)-2-Methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate (CAS 24333-02-6) is a chemical compound with the molecular formula C13H20O8 and a molecular weight of 304.29 g/mol. IUPAC name: [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate. InChIKey: RTVWBDNQHISFHI-MCNNAKBESA-N.
| Molecular formula | C13H20O8 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate |
| InChIKey | RTVWBDNQHISFHI-MCNNAKBESA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)