CAS 43139-93-1 is the registry number for (2S,3R,4S,5S,6R)-2-Methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate (CAS 43139-93-1) is a chemical compound with the molecular formula C13H20O8 and a molecular weight of 304.29 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate. InChIKey: RTVWBDNQHISFHI-XBIGMKJDSA-N.
| Molecular formula | C13H20O8 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-2-methyloxan-3-yl] acetate |
| InChIKey | RTVWBDNQHISFHI-XBIGMKJDSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)