CAS 199433-57-3 is the registry number for (R)-4-(1-Aminoethyl)-N-(pyridin-4-yl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide (CAS 199433-57-3) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide. InChIKey: LLSFXOUAPAZFIV-SNVBAGLBSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide |
| InChIKey | LLSFXOUAPAZFIV-SNVBAGLBSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)NC2=CC=NC=C2)N |
Computed by PubChem (NCBI)