CAS 199461-16-0 is the registry number for 3-(Fluorosulfonyl)-4-methoxybenzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-fluorosulfonyl-4-methoxybenzoic acid (CAS 199461-16-0) is a chemical compound with the molecular formula C8H7FO5S and a molecular weight of 234.20 g/mol. IUPAC name: 3-fluorosulfonyl-4-methoxybenzoic acid. InChIKey: TXPKNOFHNYQSLR-UHFFFAOYSA-N.
| Molecular formula | C8H7FO5S |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 3-fluorosulfonyl-4-methoxybenzoic acid |
| InChIKey | TXPKNOFHNYQSLR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)F |
Computed by PubChem (NCBI)