Products 2475190-90-8
CAS 2475190-90-8 is the registry number for 2-(4-((Fluorosulfonyl)oxy)phenyl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(4-fluorosulfonyloxyphenyl)acetic acid (CAS 2475190-90-8) is a chemical compound with the molecular formula C8H7FO5S and a molecular weight of 234.20 g/mol. IUPAC name: 2-(4-fluorosulfonyloxyphenyl)acetic acid. InChIKey: VKKAZKNXJDBINW-UHFFFAOYSA-N.
| Molecular formula | C8H7FO5S |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 2-(4-fluorosulfonyloxyphenyl)acetic acid |
| InChIKey | VKKAZKNXJDBINW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)OS(=O)(=O)F |
Computed by PubChem (NCBI)