Products 935534-26-2
CAS 935534-26-2 appears in our catalog under these names: 4-(Fluorosulfonyl)-3-methoxybenzoic acid, 95%, 95%, 4-(Fluorosulfonyl)-3-methoxybenzoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-fluorosulfonyl-3-methoxybenzoic acid (CAS 935534-26-2) is a chemical compound with the molecular formula C8H7FO5S and a molecular weight of 234.20 g/mol. IUPAC name: 4-fluorosulfonyl-3-methoxybenzoic acid. InChIKey: MMGFERAHRYVWRR-UHFFFAOYSA-N.
| Molecular formula | C8H7FO5S |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4-fluorosulfonyl-3-methoxybenzoic acid |
| InChIKey | MMGFERAHRYVWRR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)S(=O)(=O)F |
Computed by PubChem (NCBI)