CAS 199480-42-7 is the registry number for 1,2,3,4-Tetrahydroisoquinoline-2-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3,4-dihydro-1H-isoquinoline-2-carbonyl chloride (CAS 199480-42-7) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 3,4-dihydro-1H-isoquinoline-2-carbonyl chloride. InChIKey: ICQJONGSPSQPOH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 3,4-dihydro-1H-isoquinoline-2-carbonyl chloride |
| InChIKey | ICQJONGSPSQPOH-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=O)Cl |
Computed by PubChem (NCBI)