Products 1997309-40-6

CAS 1997309-40-6 is the registry number for 4-(1,1-Dimethylethyl) 1-methyl 2-propylbutanedioate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-O-tert-butyl 1-O-methyl 2-propylbutanedioate (CAS 1997309-40-6) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl 2-propylbutanedioate. InChIKey: QMDRAYZTZCIUNL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O4
Molecular weight230.30 g/mol
IUPAC name4-O-tert-butyl 1-O-methyl 2-propylbutanedioate
InChIKeyQMDRAYZTZCIUNL-UHFFFAOYSA-N
SMILESCCCC(CC(=O)OC(C)(C)C)C(=O)OC

Computed by PubChem (NCBI)