CAS 1998128-81-6 appears in our catalog under these names: Benzyldimethyldecylammonium Chloride-(D₇), >95% (HPLC), Decyldimethylbenzylammonium chloride-d7, D7-Benzyldimethyldecylammonium chloride. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 10mg, 50mg, Get quote, 1x10mg.
Decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride (CAS 1998128-81-6) is a chemical compound with the molecular formula C19H34ClN and a molecular weight of 319.0 g/mol. IUPAC name: decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride. InChIKey: TTZLKXKJIMOHHG-YQXXGYKQSA-M.
| Molecular formula | C19H34ClN |
|---|---|
| Molecular weight | 319.0 g/mol |
| IUPAC name | decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride |
| InChIKey | TTZLKXKJIMOHHG-YQXXGYKQSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[N+](C)(C)CCCCCCCCCC)[2H])[2H].[Cl-] |
Computed by PubChem (NCBI)