CAS 23616-79-7 appears in our catalog under these names: Benzyltributylammonium Chloride, Tributylbenzylammonium chloride, Benzyltri-n-butylammonium chloride, 98% , Benzyltributylammonium chloride, 98+%, Benzyltributylammonium Chloride, >98.0%(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 2,5g, 250mg, 500mg, 500g, 2500g, 100g, 5kg, 10kg.
Benzyl(tributyl)azanium chloride (CAS 23616-79-7) is a chemical compound with the molecular formula C19H34ClN and a molecular weight of 311.9 g/mol. IUPAC name: benzyl(tributyl)azanium chloride. InChIKey: VJGNLOIQCWLBJR-UHFFFAOYSA-M.
| Molecular formula | C19H34ClN |
|---|---|
| Molecular weight | 311.9 g/mol |
| IUPAC name | benzyl(tributyl)azanium chloride |
| InChIKey | VJGNLOIQCWLBJR-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)