CAS 965-32-2 appears in our catalog under these names: N-Benzyl-N,N-dimethyldecan-1-aminium chloride, 98%, N-benzyl-N,N-dimethyldecan-1-aminium chloride, Benzyldecyldimethylammonium Chloride, Benzyldecyldimethylammonium Chloride, >95% (HPLC), BENZYLDIMETHYLDECYLAMMONIUM CHLORIDE, >&. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 10g, 1g, 25g, 100g, 250mg, 5g.
Benzyl-decyl-dimethylazanium chloride (CAS 965-32-2) is a chemical compound with the molecular formula C19H34ClN and a molecular weight of 311.9 g/mol. IUPAC name: benzyl-decyl-dimethylazanium chloride. InChIKey: TTZLKXKJIMOHHG-UHFFFAOYSA-M.
| Molecular formula | C19H34ClN |
|---|---|
| Molecular weight | 311.9 g/mol |
| IUPAC name | benzyl-decyl-dimethylazanium chloride |
| InChIKey | TTZLKXKJIMOHHG-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)