Products 1998151-88-4
CAS 1998151-88-4 is the registry number for tert-Butyl 6-chloro-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-chloro-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1998151-88-4) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: tert-butyl 6-chloro-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: DSJONGANTSQFKL-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | tert-butyl 6-chloro-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | DSJONGANTSQFKL-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=CC(=N2)Cl)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)