Products 1998151-92-0
CAS 1998151-92-0 is the registry number for tert-Butyl 6-amino-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-1-carboxylate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
Tert-butyl 6-amino-2,3-dihydropyrrolo[3,2-c]pyridine-1-carboxylate (CAS 1998151-92-0) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl 6-amino-2,3-dihydropyrrolo[3,2-c]pyridine-1-carboxylate. InChIKey: HMONLEBEECTVEN-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl 6-amino-2,3-dihydropyrrolo[3,2-c]pyridine-1-carboxylate |
| InChIKey | HMONLEBEECTVEN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CN=C(C=C21)N |
Computed by PubChem (NCBI)