CAS 1998216-16-2 appears in our catalog under these names: 7,8–Dihydro–6H–(1,3)dioxolo(4,5–e)isoindole hydrochloride, 6H-1,3-Dioxolo[4,5-e]isoindole, 7,8-dihydro-, hydrochloride (1:1), 98%, 98%, 7,8-Dihydro-6H-[1,3]dioxolo[4,5-e]isoindole hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7,8-dihydro-6H-[1,3]dioxolo[4,5-e]isoindole;hydrochloride (CAS 1998216-16-2) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 7,8-dihydro-6H-[1,3]dioxolo[4,5-e]isoindole;hydrochloride. InChIKey: LTCYIVTWNAIJEW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 7,8-dihydro-6H-[1,3]dioxolo[4,5-e]isoindole;hydrochloride |
| InChIKey | LTCYIVTWNAIJEW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C3=C(C=C2)OCO3.Cl |
Computed by PubChem (NCBI)