Products 1998276-27-9

CAS 1998276-27-9 is the registry number for rac-tert-Butyl 2-{((3R,4S)-4-hydroxyoxolan-3-yl)amino}acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate (CAS 1998276-27-9) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate. InChIKey: SCNDOHHHDQDVSI-HTQZYQBOSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC nametert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate
InChIKeySCNDOHHHDQDVSI-HTQZYQBOSA-N
SMILESCC(C)(C)OC(=O)CN[C@@H]1COC[C@H]1O

Computed by PubChem (NCBI)