CAS 1998276-27-9 is the registry number for rac-tert-Butyl 2-{((3R,4S)-4-hydroxyoxolan-3-yl)amino}acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate (CAS 1998276-27-9) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate. InChIKey: SCNDOHHHDQDVSI-HTQZYQBOSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]acetate |
| InChIKey | SCNDOHHHDQDVSI-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)CN[C@@H]1COC[C@H]1O |
Computed by PubChem (NCBI)