Products 1998288-22-4
CAS 1998288-22-4 is the registry number for (4-bromo-2,3-difluorophenyl)(phenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-bromo-2,3-difluorophenyl)-phenylmethanone (CAS 1998288-22-4) is a chemical compound with the molecular formula C13H7BrF2O and a molecular weight of 297.09 g/mol. IUPAC name: (4-bromo-2,3-difluorophenyl)-phenylmethanone. InChIKey: OIJJHHIRHKVWKI-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF2O |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | (4-bromo-2,3-difluorophenyl)-phenylmethanone |
| InChIKey | OIJJHHIRHKVWKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C(=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)