CAS 844878-99-5 is the registry number for 4-Bromo-3',4'-difluorobenzophenone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
(4-bromophenyl)-(3,4-difluorophenyl)methanone (CAS 844878-99-5) is a chemical compound with the molecular formula C13H7BrF2O and a molecular weight of 297.09 g/mol. IUPAC name: (4-bromophenyl)-(3,4-difluorophenyl)methanone. InChIKey: ZBZKMVBOJLOHPU-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF2O |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | (4-bromophenyl)-(3,4-difluorophenyl)methanone |
| InChIKey | ZBZKMVBOJLOHPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC(=C(C=C2)F)F)Br |
Computed by PubChem (NCBI)