Products 844878-99-5

CAS 844878-99-5 is the registry number for 4-Bromo-3',4'-difluorobenzophenone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(4-bromophenyl)-(3,4-difluorophenyl)methanone (CAS 844878-99-5) is a chemical compound with the molecular formula C13H7BrF2O and a molecular weight of 297.09 g/mol. IUPAC name: (4-bromophenyl)-(3,4-difluorophenyl)methanone. InChIKey: ZBZKMVBOJLOHPU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H7BrF2O
Molecular weight297.09 g/mol
IUPAC name(4-bromophenyl)-(3,4-difluorophenyl)methanone
InChIKeyZBZKMVBOJLOHPU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)C2=CC(=C(C=C2)F)F)Br

Computed by PubChem (NCBI)