CAS 844879-35-2 is the registry number for 3-Bromo-3',4'-difluorobenzophenone, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(3-bromophenyl)-(3,4-difluorophenyl)methanone (CAS 844879-35-2) is a chemical compound with the molecular formula C13H7BrF2O and a molecular weight of 297.09 g/mol. IUPAC name: (3-bromophenyl)-(3,4-difluorophenyl)methanone. InChIKey: MXMRCWGRNCWZIQ-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF2O |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | (3-bromophenyl)-(3,4-difluorophenyl)methanone |
| InChIKey | MXMRCWGRNCWZIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)